About 5-prop-2-enylnonan-2-ol
5-prop-2-enylnonan-2-ol (PubChem CID 91603961) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is 5-prop-2-enylnonan-2-ol.
Molecular Properties
| Compound Name | 5-prop-2-enylnonan-2-ol |
| PubChem CID | 91603961 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 5-prop-2-enylnonan-2-ol |
| SMILES | C=CCC(CCCC)CCC(C)O |
| InChI | InChI=1S/C12H24O/c1-4-6-8-12(7-5-2)10-9-11(3)13/h5,11-13H,2,4,6-10H2,1,3H3 |
| InChIKey | MTHOIHNGRQETJP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-prop-2-enylnonan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-2-enylnonan-2-ol?
The IUPAC name of 5-prop-2-enylnonan-2-ol (CID 91603961) is 5-prop-2-enylnonan-2-ol.
What is the SMILES notation for 5-prop-2-enylnonan-2-ol?
The canonical SMILES for 5-prop-2-enylnonan-2-ol is C=CCC(CCCC)CCC(C)O.
What is the InChIKey of 5-prop-2-enylnonan-2-ol?
The InChIKey is MTHOIHNGRQETJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O/c1-4-6-8-12(7-5-2)10-9-11(3)13/h5,11-13H,2,4,6-10H2,1,3H3.
What are the key properties of 5-prop-2-enylnonan-2-ol?
5-prop-2-enylnonan-2-ol has a molecular weight of 184.32 g/mol, XLogP of 3.53, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-2-enylnonan-2-ol is sourced from PubChem (CID 91603961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).