About 4-ethyloct-1-ene;hexanedioic acid
4-ethyloct-1-ene;hexanedioic acid (PubChem CID 175450276) has the molecular formula C16H30O4
and a molecular weight of 286.41 g/mol. Its IUPAC name is 4-ethyloct-1-ene;hexanedioic acid.
Molecular Properties
| Compound Name | 4-ethyloct-1-ene;hexanedioic acid |
| PubChem CID | 175450276 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 4-ethyloct-1-ene;hexanedioic acid |
| SMILES | C=CCC(CC)CCCC.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C10H20.C6H10O4/c1-4-7-9-10(6-3)8-5-2;7-5(8)3-1-2-4-6(9)10/h5,10H,2,4,6-9H2,1,3H3;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | XRAYLCIQJHCSGO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyloct-1-ene;hexanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyloct-1-ene;hexanedioic acid?
The IUPAC name of 4-ethyloct-1-ene;hexanedioic acid (CID 175450276) is 4-ethyloct-1-ene;hexanedioic acid.
What is the SMILES notation for 4-ethyloct-1-ene;hexanedioic acid?
The canonical SMILES for 4-ethyloct-1-ene;hexanedioic acid is C=CCC(CC)CCCC.O=C(O)CCCCC(=O)O.
What is the InChIKey of 4-ethyloct-1-ene;hexanedioic acid?
The InChIKey is XRAYLCIQJHCSGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.C6H10O4/c1-4-7-9-10(6-3)8-5-2;7-5(8)3-1-2-4-6(9)10/h5,10H,2,4,6-9H2,1,3H3;1-4H2,(H,7,8)(H,9,10).
What are the key properties of 4-ethyloct-1-ene;hexanedioic acid?
4-ethyloct-1-ene;hexanedioic acid has a molecular weight of 286.41 g/mol, XLogP of 4.49, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyloct-1-ene;hexanedioic acid is sourced from PubChem (CID 175450276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).