C8H6F8O — CID 22186473
1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol (PubChem CID 22186473) has the molecular formula C8H6F8O and a molecular weight of 270.12 g/mol. Its IUPAC name is 1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol.
| Compound Name | 1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 22186473 |
| Molecular Formula | C8H6F8O |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
| SMILES | C=CCC(O)(C(F)(F)F)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C8H6F8O/c1-2-3-6(17,8(14,15)16)7(12,13)4(9)5(10)11/h2,17H,1,3H2 |
| InChIKey | ZEERSBCGGBPZIJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|