C10H8F12O2 — CID 87143588
(E)-1,1,1,8,8,8-hexafluoro-2,7-bis(trifluoromethyl)oct-4-ene-2,7-diol (PubChem CID 87143588) has the molecular formula C10H8F12O2 and a molecular weight of 388.15 g/mol. Its IUPAC name is (E)-1,1,1,8,8,8-hexafluoro-2,7-bis(trifluoromethyl)oct-4-ene-2,7-diol.
| Compound Name | (E)-1,1,1,8,8,8-hexafluoro-2,7-bis(trifluoromethyl)oct-4-ene-2,7-diol |
|---|---|
| PubChem CID | 87143588 |
| Molecular Formula | C10H8F12O2 |
| Molecular Weight | 388.15 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | (E)-1,1,1,8,8,8-hexafluoro-2,7-bis(trifluoromethyl)oct-4-ene-2,7-diol |
| SMILES | OC(C/C=C/CC(O)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F12O2/c11-7(12,13)5(23,8(14,15)16)3-1-2-4-6(24,9(17,18)19)10(20,21)22/h1-2,23-24H,3-4H2/b2-1+ |
| InChIKey | QRESLSSBKZBMJP-OWOJBTEDSA-N |
| XLogP | 4.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.15 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|