C11H11F11O — CID 88765155
4,4,5,5,5-pentafluoropent-1-ene;1,1,1-trifluoro-2-(trifluoromethyl)pent-4-en-2-ol (PubChem CID 88765155) has the molecular formula C11H11F11O and a molecular weight of 368.19 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoropent-1-ene;1,1,1-trifluoro-2-(trifluoromethyl)pent-4-en-2-ol.
| Compound Name | 4,4,5,5,5-pentafluoropent-1-ene;1,1,1-trifluoro-2-(trifluoromethyl)pent-4-en-2-ol |
|---|---|
| PubChem CID | 88765155 |
| Molecular Formula | C11H11F11O |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4,4,5,5,5-pentafluoropent-1-ene;1,1,1-trifluoro-2-(trifluoromethyl)pent-4-en-2-ol |
| SMILES | C=CCC(F)(F)C(F)(F)F.C=CCC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H6F6O.C5H5F5/c1-2-3-4(13,5(7,8)9)6(10,11)12;1-2-3-4(6,7)5(8,9)10/h2,13H,1,3H2;2H,1,3H2 |
| InChIKey | BWAGQPUGOBIELB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|