C11H18O3 — CID 155341339
2,2-bis(prop-2-enyl)pent-4-ene-1,1,1-triol (PubChem CID 155341339) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 2,2-bis(prop-2-enyl)pent-4-ene-1,1,1-triol.
| Compound Name | 2,2-bis(prop-2-enyl)pent-4-ene-1,1,1-triol |
|---|---|
| PubChem CID | 155341339 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2,2-bis(prop-2-enyl)pent-4-ene-1,1,1-triol |
| SMILES | C=CCC(CC=C)(CC=C)C(O)(O)O |
| InChI | InChI=1S/C11H18O3/c1-4-7-10(8-5-2,9-6-3)11(12,13)14/h4-6,12-14H,1-3,7-9H2 |
| InChIKey | UAQQCASGTJKLHZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|