C7H6F8O — CID 20743967
1,1,1,2,2-pentafluoro-3-(trifluoromethyl)hex-5-en-3-ol (PubChem CID 20743967) has the molecular formula C7H6F8O and a molecular weight of 258.11 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-3-(trifluoromethyl)hex-5-en-3-ol.
| Compound Name | 1,1,1,2,2-pentafluoro-3-(trifluoromethyl)hex-5-en-3-ol |
|---|---|
| PubChem CID | 20743967 |
| Molecular Formula | C7H6F8O |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-3-(trifluoromethyl)hex-5-en-3-ol |
| SMILES | C=CCC(O)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F8O/c1-2-3-4(16,6(10,11)12)5(8,9)7(13,14)15/h2,16H,1,3H2 |
| InChIKey | PCYQTHARHTYIMK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|