C10H14F6O — CID 147960581
(E)-1,1,1-trifluoro-2-(trifluoromethyl)non-4-en-2-ol (PubChem CID 147960581) has the molecular formula C10H14F6O and a molecular weight of 264.21 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-2-(trifluoromethyl)non-4-en-2-ol.
| Compound Name | (E)-1,1,1-trifluoro-2-(trifluoromethyl)non-4-en-2-ol |
|---|---|
| PubChem CID | 147960581 |
| Molecular Formula | C10H14F6O |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (E)-1,1,1-trifluoro-2-(trifluoromethyl)non-4-en-2-ol |
| SMILES | CCCC/C=C/CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H14F6O/c1-2-3-4-5-6-7-8(17,9(11,12)13)10(14,15)16/h5-6,17H,2-4,7H2,1H3/b6-5+ |
| InChIKey | IPKBXDWGKVCPSC-AATRIKPKSA-N |
| XLogP | 3.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|