C10H8F12O6 — CID 139080677
4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanoic acid (PubChem CID 139080677) has the molecular formula C10H8F12O6 and a molecular weight of 452.14 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanoic acid.
| Compound Name | 4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanoic acid |
|---|---|
| PubChem CID | 139080677 |
| Molecular Formula | C10H8F12O6 |
| Molecular Weight | 452.14 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | 4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanoic acid |
| SMILES | O=C(O)CC(O)(C(F)(F)F)C(F)(F)F.O=C(O)CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/2C5H4F6O3/c2*6-4(7,8)3(14,1-2(12)13)5(9,10)11/h2*14H,1H2,(H,12,13) |
| InChIKey | CLBAOZATFQQCJA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.14 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |