C7H6F6O3 — CID 58823536
5,5,5-trifluoro-4-hydroxy-2-methylidene-4-(trifluoromethyl)pentanoic acid (PubChem CID 58823536) has the molecular formula C7H6F6O3 and a molecular weight of 252.11 g/mol. Its IUPAC name is 5,5,5-trifluoro-4-hydroxy-2-methylidene-4-(trifluoromethyl)pentanoic acid.
| Compound Name | 5,5,5-trifluoro-4-hydroxy-2-methylidene-4-(trifluoromethyl)pentanoic acid |
|---|---|
| PubChem CID | 58823536 |
| Molecular Formula | C7H6F6O3 |
| Molecular Weight | 252.11 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 5,5,5-trifluoro-4-hydroxy-2-methylidene-4-(trifluoromethyl)pentanoic acid |
| SMILES | C=C(CC(O)(C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C7H6F6O3/c1-3(4(14)15)2-5(16,6(8,9)10)7(11,12)13/h16H,1-2H2,(H,14,15) |
| InChIKey | KKGJLHQYFGOVFN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.11 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|