C5H8F3O5P — CID 157210793
phosphorous acid;4,4,4-trifluoro-2-methylidenebutanoic acid (PubChem CID 157210793) has the molecular formula C5H8F3O5P and a molecular weight of 236.08 g/mol. Its IUPAC name is phosphorous acid;4,4,4-trifluoro-2-methylidenebutanoic acid.
| Compound Name | phosphorous acid;4,4,4-trifluoro-2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 157210793 |
| Molecular Formula | C5H8F3O5P |
| Molecular Weight | 236.08 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | phosphorous acid;4,4,4-trifluoro-2-methylidenebutanoic acid |
| SMILES | C=C(CC(F)(F)F)C(=O)O.OP(O)O |
| InChI | InChI=1S/C5H5F3O2.H3O3P/c1-3(4(9)10)2-5(6,7)8;1-4(2)3/h1-2H2,(H,9,10);1-3H |
| InChIKey | ARWHSQAJUACWMY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.08 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|