C7H6F6O4 — CID 58823596
2-[(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)oxymethyl]prop-2-enoic acid (PubChem CID 58823596) has the molecular formula C7H6F6O4 and a molecular weight of 268.11 g/mol. Its IUPAC name is 2-[(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)oxymethyl]prop-2-enoic acid.
| Compound Name | 2-[(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)oxymethyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58823596 |
| Molecular Formula | C7H6F6O4 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 2-[(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)oxymethyl]prop-2-enoic acid |
| SMILES | C=C(COC(O)(C(F)(F)F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C7H6F6O4/c1-3(4(14)15)2-17-5(16,6(8,9)10)7(11,12)13/h16H,1-2H2,(H,14,15) |
| InChIKey | UARQEEGMCGRYCF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|