C11H8ClF3O3 — CID 166364773
2-[[4-chloro-3-(trifluoromethyl)phenoxy]methyl]prop-2-enoic acid (PubChem CID 166364773) has the molecular formula C11H8ClF3O3 and a molecular weight of 280.63 g/mol. Its IUPAC name is 2-[[4-chloro-3-(trifluoromethyl)phenoxy]methyl]prop-2-enoic acid.
| Compound Name | 2-[[4-chloro-3-(trifluoromethyl)phenoxy]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 166364773 |
| Molecular Formula | C11H8ClF3O3 |
| Molecular Weight | 280.63 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 2-[[4-chloro-3-(trifluoromethyl)phenoxy]methyl]prop-2-enoic acid |
| SMILES | C=C(COc1ccc(Cl)c(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C11H8ClF3O3/c1-6(10(16)17)5-18-7-2-3-9(12)8(4-7)11(13,14)15/h2-4H,1,5H2,(H,16,17) |
| InChIKey | OAHMLOXZYSWIIM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|