C21H22ClF3O2S — CID 58534144
1-chloro-4-[2-[(3-methyl-4-propoxyphenyl)sulfanylmethyl]prop-2-enoxy]-2-(trifluoromethyl)benzene (PubChem CID 58534144) has the molecular formula C21H22ClF3O2S and a molecular weight of 430.92 g/mol. Its IUPAC name is 1-chloro-4-[2-[(3-methyl-4-propoxyphenyl)sulfanylmethyl]prop-2-enoxy]-2-(trifluoromethyl)benzene.
| Compound Name | 1-chloro-4-[2-[(3-methyl-4-propoxyphenyl)sulfanylmethyl]prop-2-enoxy]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 58534144 |
| Molecular Formula | C21H22ClF3O2S |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 1-chloro-4-[2-[(3-methyl-4-propoxyphenyl)sulfanylmethyl]prop-2-enoxy]-2-(trifluoromethyl)benzene |
| SMILES | C=C(COc1ccc(Cl)c(C(F)(F)F)c1)CSc1ccc(OCCC)c(C)c1 |
| InChI | InChI=1S/C21H22ClF3O2S/c1-4-9-26-20-8-6-17(10-15(20)3)28-13-14(2)12-27-16-5-7-19(22)18(11-16)21(23,24)25/h5-8,10-11H,2,4,9,12-13H2,1,3H3 |
| InChIKey | ULXIIIMILWCYAM-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|