C18H18Cl2O2S — CID 70657654
1,2-dichloro-4-[2-[(4-methoxy-3-methylphenyl)sulfanylmethyl]prop-2-enoxy]benzene (PubChem CID 70657654) has the molecular formula C18H18Cl2O2S and a molecular weight of 369.31 g/mol. Its IUPAC name is 1,2-dichloro-4-[2-[(4-methoxy-3-methylphenyl)sulfanylmethyl]prop-2-enoxy]benzene.
| Compound Name | 1,2-dichloro-4-[2-[(4-methoxy-3-methylphenyl)sulfanylmethyl]prop-2-enoxy]benzene |
|---|---|
| PubChem CID | 70657654 |
| Molecular Formula | C18H18Cl2O2S |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 1,2-dichloro-4-[2-[(4-methoxy-3-methylphenyl)sulfanylmethyl]prop-2-enoxy]benzene |
| SMILES | C=C(COc1ccc(Cl)c(Cl)c1)CSc1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C18H18Cl2O2S/c1-12(10-22-14-4-6-16(19)17(20)9-14)11-23-15-5-7-18(21-3)13(2)8-15/h4-9H,1,10-11H2,2-3H3 |
| InChIKey | QZPKEBIQCSNTCV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|