C13H15ClO — CID 11673009
1-chloro-2-methyl-4-(2-methylidenepent-4-enoxy)benzene (PubChem CID 11673009) has the molecular formula C13H15ClO and a molecular weight of 222.71 g/mol. Its IUPAC name is 1-chloro-2-methyl-4-(2-methylidenepent-4-enoxy)benzene.
| Compound Name | 1-chloro-2-methyl-4-(2-methylidenepent-4-enoxy)benzene |
|---|---|
| PubChem CID | 11673009 |
| Molecular Formula | C13H15ClO |
| Molecular Weight | 222.71 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-chloro-2-methyl-4-(2-methylidenepent-4-enoxy)benzene |
| SMILES | C=CCC(=C)COc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C13H15ClO/c1-4-5-10(2)9-15-12-6-7-13(14)11(3)8-12/h4,6-8H,1-2,5,9H2,3H3 |
| InChIKey | CMIPXNGBKPNLGP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.71 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|