C17H17Cl2NO2S — CID 7604221
2-(3,4-dichlorophenoxy)-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 7604221) has the molecular formula C17H17Cl2NO2S and a molecular weight of 370.30 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2-(3,4-dichlorophenoxy)-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 7604221 |
| Molecular Formula | C17H17Cl2NO2S |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | Cc1ccc(SCCNC(=O)COc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H17Cl2NO2S/c1-12-2-5-14(6-3-12)23-9-8-20-17(21)11-22-13-4-7-15(18)16(19)10-13/h2-7,10H,8-9,11H2,1H3,(H,20,21) |
| InChIKey | VHSHKFWMCHQGPM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|