About [4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate
[4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate (PubChem CID 118592799) has the molecular formula C14H14ClF3O3
and a molecular weight of 322.71 g/mol. Its IUPAC name is [4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate.
Molecular Properties
| Compound Name | [4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate |
| PubChem CID | 118592799 |
| Molecular Formula | C14H14ClF3O3 |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | [4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate |
| SMILES | CC(=O)CCCCC(=O)Oc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14ClF3O3/c1-9(19)4-2-3-5-13(20)21-10-6-7-12(15)11(8-10)14(16,17)18/h6-8H,2-5H2,1H3 |
| InChIKey | NIGPIZWBURHDOZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate?
The IUPAC name of [4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate (CID 118592799) is [4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate.
What is the SMILES notation for [4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate?
The canonical SMILES for [4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate is CC(=O)CCCCC(=O)Oc1ccc(Cl)c(C(F)(F)F)c1.
What is the InChIKey of [4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate?
The InChIKey is NIGPIZWBURHDOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClF3O3/c1-9(19)4-2-3-5-13(20)21-10-6-7-12(15)11(8-10)14(16,17)18/h6-8H,2-5H2,1H3.
What are the key properties of [4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate?
[4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate has a molecular weight of 322.71 g/mol, XLogP of 4.41, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-chloro-3-(trifluoromethyl)phenyl] 6-oxoheptanoate is sourced from PubChem (CID 118592799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).