C11H11ClF3N2O+ — CID 147668541
[(Z)-3-amino-1-[4-chloro-3-(trifluoromethyl)phenoxy]but-2-enylidene]azanium (PubChem CID 147668541) has the molecular formula C11H11ClF3N2O+ and a molecular weight of 279.67 g/mol. Its IUPAC name is [(Z)-3-amino-1-[4-chloro-3-(trifluoromethyl)phenoxy]but-2-enylidene]azanium.
| Compound Name | [(Z)-3-amino-1-[4-chloro-3-(trifluoromethyl)phenoxy]but-2-enylidene]azanium |
|---|---|
| PubChem CID | 147668541 |
| Molecular Formula | C11H11ClF3N2O+ |
| Molecular Weight | 279.67 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | [(Z)-3-amino-1-[4-chloro-3-(trifluoromethyl)phenoxy]but-2-enylidene]azanium |
| SMILES | C/C(N)=C/C(=[NH2+])Oc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10ClF3N2O/c1-6(16)4-10(17)18-7-2-3-9(12)8(5-7)11(13,14)15/h2-5,17H,16H2,1H3/p+1/b6-4-,17-10? |
| InChIKey | GMTVVPJMIYLHEA-MWUFWLBXSA-O |
| XLogP | 1.76 |
| TPSA | 60.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.67 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|