C30H26Cl2F6N2O2 — CID 86666229
2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethanamine (PubChem CID 86666229) has the molecular formula C30H26Cl2F6N2O2 and a molecular weight of 631.44 g/mol. Its IUPAC name is 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethanamine.
| Compound Name | 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 86666229 |
| Molecular Formula | C30H26Cl2F6N2O2 |
| Molecular Weight | 631.44 g/mol |
| Exact Mass | 630.13 |
| IUPAC Name | 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethanamine |
| SMILES | NCCc1ccc(Oc2ccc(Cl)c(C(F)(F)F)c2)cc1.NCCc1ccc(Oc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/2C15H13ClF3NO/c2*16-14-6-5-12(9-13(14)15(17,18)19)21-11-3-1-10(2-4-11)7-8-20/h2*1-6,9H,7-8,20H2 |
| InChIKey | QAAASIGOGPWACN-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.44 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |