C19H15ClF3N3O2 — CID 118481107
1-[2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethylamino]pyrimidin-4-one (PubChem CID 118481107) has the molecular formula C19H15ClF3N3O2 and a molecular weight of 409.80 g/mol. Its IUPAC name is 1-[2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethylamino]pyrimidin-4-one.
| Compound Name | 1-[2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethylamino]pyrimidin-4-one |
|---|---|
| PubChem CID | 118481107 |
| Molecular Formula | C19H15ClF3N3O2 |
| Molecular Weight | 409.80 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 1-[2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethylamino]pyrimidin-4-one |
| SMILES | O=c1ccn(NCCc2ccc(Oc3ccc(Cl)c(C(F)(F)F)c3)cc2)cn1 |
| InChI | InChI=1S/C19H15ClF3N3O2/c20-17-6-5-15(11-16(17)19(21,22)23)28-14-3-1-13(2-4-14)7-9-25-26-10-8-18(27)24-12-26/h1-6,8,10-12,25H,7,9H2 |
| InChIKey | KHTRMDXMPNZVPG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.80 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |