C21H17ClF3NO3 — CID 67966666
4-[[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]methoxy]-1-ethylpyridin-2-one (PubChem CID 67966666) has the molecular formula C21H17ClF3NO3 and a molecular weight of 423.82 g/mol. Its IUPAC name is 4-[[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]methoxy]-1-ethylpyridin-2-one.
| Compound Name | 4-[[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]methoxy]-1-ethylpyridin-2-one |
|---|---|
| PubChem CID | 67966666 |
| Molecular Formula | C21H17ClF3NO3 |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 4-[[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]methoxy]-1-ethylpyridin-2-one |
| SMILES | CCn1ccc(OCc2ccc(Oc3ccc(Cl)c(C(F)(F)F)c3)cc2)cc1=O |
| InChI | InChI=1S/C21H17ClF3NO3/c1-2-26-10-9-16(12-20(26)27)28-13-14-3-5-15(6-4-14)29-17-7-8-19(22)18(11-17)21(23,24)25/h3-12H,2,13H2,1H3 |
| InChIKey | PAQZIYJTVBJGBN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |