C15H12ClF3O2 — CID 66825529
2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethanol (PubChem CID 66825529) has the molecular formula C15H12ClF3O2 and a molecular weight of 316.71 g/mol. Its IUPAC name is 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethanol.
| Compound Name | 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 66825529 |
| Molecular Formula | C15H12ClF3O2 |
| Molecular Weight | 316.71 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethanol |
| SMILES | OCCc1ccc(Oc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H12ClF3O2/c16-14-6-5-12(9-13(14)15(17,18)19)21-11-3-1-10(2-4-11)7-8-20/h1-6,9,20H,7-8H2 |
| InChIKey | KOGJRWLMIOGPRO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.71 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |