C21H23ClF3NO3 — CID 67775169
tert-butyl N-[2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl]-N-methylcarbamate (PubChem CID 67775169) has the molecular formula C21H23ClF3NO3 and a molecular weight of 429.87 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 67775169 |
| Molecular Formula | C21H23ClF3NO3 |
| Molecular Weight | 429.87 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | tert-butyl N-[2-[4-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]ethyl]-N-methylcarbamate |
| SMILES | CN(CCc1ccc(Oc2ccc(Cl)c(C(F)(F)F)c2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H23ClF3NO3/c1-20(2,3)29-19(27)26(4)12-11-14-5-7-15(8-6-14)28-16-9-10-18(22)17(13-16)21(23,24)25/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | ASARNFDEBGBQPF-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.87 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |