C9H15F3O2Si — CID 87921366
2-[[dimethyl(3,3,3-trifluoropropyl)silyl]methyl]prop-2-enoic acid (PubChem CID 87921366) has the molecular formula C9H15F3O2Si and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-[[dimethyl(3,3,3-trifluoropropyl)silyl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[dimethyl(3,3,3-trifluoropropyl)silyl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 87921366 |
| Molecular Formula | C9H15F3O2Si |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-[[dimethyl(3,3,3-trifluoropropyl)silyl]methyl]prop-2-enoic acid |
| SMILES | C=C(C[Si](C)(C)CCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C9H15F3O2Si/c1-7(8(13)14)6-15(2,3)5-4-9(10,11)12/h1,4-6H2,2-3H3,(H,13,14) |
| InChIKey | KRVCHXRNDGTIFZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|