C18H36O4Si2 — CID 161226856
tert-butyl 2-(trimethylsilylmethyl)prop-2-enoate;2-(trimethylsilylmethyl)prop-2-enoic acid (PubChem CID 161226856) has the molecular formula C18H36O4Si2 and a molecular weight of 372.65 g/mol. Its IUPAC name is tert-butyl 2-(trimethylsilylmethyl)prop-2-enoate;2-(trimethylsilylmethyl)prop-2-enoic acid.
| Compound Name | tert-butyl 2-(trimethylsilylmethyl)prop-2-enoate;2-(trimethylsilylmethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 161226856 |
| Molecular Formula | C18H36O4Si2 |
| Molecular Weight | 372.65 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | tert-butyl 2-(trimethylsilylmethyl)prop-2-enoate;2-(trimethylsilylmethyl)prop-2-enoic acid |
| SMILES | C=C(C[Si](C)(C)C)C(=O)O.C=C(C[Si](C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22O2Si.C7H14O2Si/c1-9(8-14(5,6)7)10(12)13-11(2,3)4;1-6(7(8)9)5-10(2,3)4/h1,8H2,2-7H3;1,5H2,2-4H3,(H,8,9) |
| InChIKey | UYFXEIQKYHKJTN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|