About tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride
tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride (PubChem CID 88512877) has the molecular formula C10H20FNO2
and a molecular weight of 205.27 g/mol. Its IUPAC name is tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride.
Molecular Properties
| Compound Name | tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride |
| PubChem CID | 88512877 |
| Molecular Formula | C10H20FNO2 |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride |
| SMILES | C=C(CCCN)C(=O)OC(C)(C)C.F |
| InChI | InChI=1S/C10H19NO2.FH/c1-8(6-5-7-11)9(12)13-10(2,3)4;/h1,5-7,11H2,2-4H3;1H |
| InChIKey | JRRFQUZSLABKRA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride?
The IUPAC name of tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride (CID 88512877) is tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride.
What is the SMILES notation for tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride?
The canonical SMILES for tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride is C=C(CCCN)C(=O)OC(C)(C)C.F.
What is the InChIKey of tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride?
The InChIKey is JRRFQUZSLABKRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.FH/c1-8(6-5-7-11)9(12)13-10(2,3)4;/h1,5-7,11H2,2-4H3;1H.
What are the key properties of tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride?
tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride has a molecular weight of 205.27 g/mol, XLogP of 1.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-amino-2-methylidenepentanoate;hydrofluoride is sourced from PubChem (CID 88512877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).