About trifluoromethyl 2-methylidenedecanoate
trifluoromethyl 2-methylidenedecanoate (PubChem CID 90990908) has the molecular formula C12H19F3O2
and a molecular weight of 252.28 g/mol. Its IUPAC name is trifluoromethyl 2-methylidenedecanoate.
Molecular Properties
| Compound Name | trifluoromethyl 2-methylidenedecanoate |
| PubChem CID | 90990908 |
| Molecular Formula | C12H19F3O2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | trifluoromethyl 2-methylidenedecanoate |
| SMILES | C=C(CCCCCCCC)C(=O)OC(F)(F)F |
| InChI | InChI=1S/C12H19F3O2/c1-3-4-5-6-7-8-9-10(2)11(16)17-12(13,14)15/h2-9H2,1H3 |
| InChIKey | FYUOWQWHWZGLQA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethyl 2-methylidenedecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethyl 2-methylidenedecanoate?
The IUPAC name of trifluoromethyl 2-methylidenedecanoate (CID 90990908) is trifluoromethyl 2-methylidenedecanoate.
What is the SMILES notation for trifluoromethyl 2-methylidenedecanoate?
The canonical SMILES for trifluoromethyl 2-methylidenedecanoate is C=C(CCCCCCCC)C(=O)OC(F)(F)F.
What is the InChIKey of trifluoromethyl 2-methylidenedecanoate?
The InChIKey is FYUOWQWHWZGLQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F3O2/c1-3-4-5-6-7-8-9-10(2)11(16)17-12(13,14)15/h2-9H2,1H3.
What are the key properties of trifluoromethyl 2-methylidenedecanoate?
trifluoromethyl 2-methylidenedecanoate has a molecular weight of 252.28 g/mol, XLogP of 4.36, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethyl 2-methylidenedecanoate is sourced from PubChem (CID 90990908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).