About fluoromethyl 2-methylidenenonanoate
fluoromethyl 2-methylidenenonanoate (PubChem CID 160819966) has the molecular formula C11H19FO2
and a molecular weight of 202.27 g/mol. Its IUPAC name is fluoromethyl 2-methylidenenonanoate.
Molecular Properties
| Compound Name | fluoromethyl 2-methylidenenonanoate |
| PubChem CID | 160819966 |
| Molecular Formula | C11H19FO2 |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | fluoromethyl 2-methylidenenonanoate |
| SMILES | C=C(CCCCCCC)C(=O)OCF |
| InChI | InChI=1S/C11H19FO2/c1-3-4-5-6-7-8-10(2)11(13)14-9-12/h2-9H2,1H3 |
| InChIKey | SFKIHLDLQKDVKY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze fluoromethyl 2-methylidenenonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethyl 2-methylidenenonanoate?
The IUPAC name of fluoromethyl 2-methylidenenonanoate (CID 160819966) is fluoromethyl 2-methylidenenonanoate.
What is the SMILES notation for fluoromethyl 2-methylidenenonanoate?
The canonical SMILES for fluoromethyl 2-methylidenenonanoate is C=C(CCCCCCC)C(=O)OCF.
What is the InChIKey of fluoromethyl 2-methylidenenonanoate?
The InChIKey is SFKIHLDLQKDVKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19FO2/c1-3-4-5-6-7-8-10(2)11(13)14-9-12/h2-9H2,1H3.
What are the key properties of fluoromethyl 2-methylidenenonanoate?
fluoromethyl 2-methylidenenonanoate has a molecular weight of 202.27 g/mol, XLogP of 3.37, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethyl 2-methylidenenonanoate is sourced from PubChem (CID 160819966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).