About 4-aminobutyl 6-amino-2-methylidenehexanoate
4-aminobutyl 6-amino-2-methylidenehexanoate (PubChem CID 57271260) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 4-aminobutyl 6-amino-2-methylidenehexanoate.
Molecular Properties
| Compound Name | 4-aminobutyl 6-amino-2-methylidenehexanoate |
| PubChem CID | 57271260 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 4-aminobutyl 6-amino-2-methylidenehexanoate |
| SMILES | C=C(CCCCN)C(=O)OCCCCN |
| InChI | InChI=1S/C11H22N2O2/c1-10(6-2-3-7-12)11(14)15-9-5-4-8-13/h1-9,12-13H2 |
| InChIKey | KJSOFDPMXYBSLM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobutyl 6-amino-2-methylidenehexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobutyl 6-amino-2-methylidenehexanoate?
The IUPAC name of 4-aminobutyl 6-amino-2-methylidenehexanoate (CID 57271260) is 4-aminobutyl 6-amino-2-methylidenehexanoate.
What is the SMILES notation for 4-aminobutyl 6-amino-2-methylidenehexanoate?
The canonical SMILES for 4-aminobutyl 6-amino-2-methylidenehexanoate is C=C(CCCCN)C(=O)OCCCCN.
What is the InChIKey of 4-aminobutyl 6-amino-2-methylidenehexanoate?
The InChIKey is KJSOFDPMXYBSLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-10(6-2-3-7-12)11(14)15-9-5-4-8-13/h1-9,12-13H2.
What are the key properties of 4-aminobutyl 6-amino-2-methylidenehexanoate?
4-aminobutyl 6-amino-2-methylidenehexanoate has a molecular weight of 214.31 g/mol, XLogP of 0.95, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobutyl 6-amino-2-methylidenehexanoate is sourced from PubChem (CID 57271260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).