About 3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate
3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate (PubChem CID 88830321) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate.
Molecular Properties
| Compound Name | 3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate |
| PubChem CID | 88830321 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate |
| SMILES | C=CC(=O)OCCCOC(=O)C(=C)CCN |
| InChI | InChI=1S/C11H17NO4/c1-3-10(13)15-7-4-8-16-11(14)9(2)5-6-12/h3H,1-2,4-8,12H2 |
| InChIKey | OOJFCGAGNUNOTR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate?
The IUPAC name of 3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate (CID 88830321) is 3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate.
What is the SMILES notation for 3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate?
The canonical SMILES for 3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate is C=CC(=O)OCCCOC(=O)C(=C)CCN.
What is the InChIKey of 3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate?
The InChIKey is OOJFCGAGNUNOTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO4/c1-3-10(13)15-7-4-8-16-11(14)9(2)5-6-12/h3H,1-2,4-8,12H2.
What are the key properties of 3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate?
3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate has a molecular weight of 227.26 g/mol, XLogP of 0.55, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enoyloxypropyl 4-amino-2-methylidenebutanoate is sourced from PubChem (CID 88830321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).