C10H9F3O3 — CID 3879446
4,4,4-trifluoro-3-hydroxy-3-phenylbutanoic acid (PubChem CID 3879446) has the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-hydroxy-3-phenylbutanoic acid.
| Compound Name | 4,4,4-trifluoro-3-hydroxy-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 3879446 |
| Molecular Formula | C10H9F3O3 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 4,4,4-trifluoro-3-hydroxy-3-phenylbutanoic acid |
| SMILES | O=C(O)CC(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O3/c11-10(12,13)9(16,6-8(14)15)7-4-2-1-3-5-7/h1-5,16H,6H2,(H,14,15) |
| InChIKey | YWGWRGLPYNFJRQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |