C18H15F3O4 — CID 59407430
methyl 4-(4,4,4-trifluoro-3-hydroxy-3-phenylbutanoyl)benzoate (PubChem CID 59407430) has the molecular formula C18H15F3O4 and a molecular weight of 352.31 g/mol. Its IUPAC name is methyl 4-(4,4,4-trifluoro-3-hydroxy-3-phenylbutanoyl)benzoate.
| Compound Name | methyl 4-(4,4,4-trifluoro-3-hydroxy-3-phenylbutanoyl)benzoate |
|---|---|
| PubChem CID | 59407430 |
| Molecular Formula | C18H15F3O4 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | methyl 4-(4,4,4-trifluoro-3-hydroxy-3-phenylbutanoyl)benzoate |
| SMILES | COC(=O)c1ccc(C(=O)CC(O)(c2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F3O4/c1-25-16(23)13-9-7-12(8-10-13)15(22)11-17(24,18(19,20)21)14-5-3-2-4-6-14/h2-10,24H,11H2,1H3 |
| InChIKey | GMKILLNWCMPIBI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |