C15H16F8O — CID 23591032
6-(2-bicyclo[2.2.1]heptanyl)-1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol (PubChem CID 23591032) has the molecular formula C15H16F8O and a molecular weight of 364.28 g/mol. Its IUPAC name is 6-(2-bicyclo[2.2.1]heptanyl)-1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol.
| Compound Name | 6-(2-bicyclo[2.2.1]heptanyl)-1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 23591032 |
| Molecular Formula | C15H16F8O |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 6-(2-bicyclo[2.2.1]heptanyl)-1,1,2,3,3-pentafluoro-4-(trifluoromethyl)hepta-1,6-dien-4-ol |
| SMILES | C=C(CC(O)(C(F)(F)F)C(F)(F)C(F)=C(F)F)C1CC2CCC1C2 |
| InChI | InChI=1S/C15H16F8O/c1-7(10-5-8-2-3-9(10)4-8)6-13(24,15(21,22)23)14(19,20)11(16)12(17)18/h8-10,24H,1-6H2 |
| InChIKey | BNDASEWRSNIDHC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|