C20H34F6O — CID 91137531
8-(2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-(trifluoromethyl)octan-2-ol;2-methylpropane (PubChem CID 91137531) has the molecular formula C20H34F6O and a molecular weight of 404.48 g/mol. Its IUPAC name is 8-(2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-(trifluoromethyl)octan-2-ol;2-methylpropane.
| Compound Name | 8-(2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-(trifluoromethyl)octan-2-ol;2-methylpropane |
|---|---|
| PubChem CID | 91137531 |
| Molecular Formula | C20H34F6O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 8-(2-bicyclo[2.2.1]heptanyl)-1,1,1-trifluoro-2-(trifluoromethyl)octan-2-ol;2-methylpropane |
| SMILES | CC(C)C.OC(CCCCCCC1CC2CCC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H24F6O.C4H10/c17-15(18,19)14(23,16(20,21)22)8-4-2-1-3-5-12-9-11-6-7-13(12)10-11;1-4(2)3/h11-13,23H,1-10H2;4H,1-3H3 |
| InChIKey | SPHNQEFQLVGSGA-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|