C15H27Br — CID 79550170
2-(4-bromo-5,5-dimethylhexyl)bicyclo[2.2.1]heptane (PubChem CID 79550170) has the molecular formula C15H27Br and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-(4-bromo-5,5-dimethylhexyl)bicyclo[2.2.1]heptane.
| Compound Name | 2-(4-bromo-5,5-dimethylhexyl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 79550170 |
| Molecular Formula | C15H27Br |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-(4-bromo-5,5-dimethylhexyl)bicyclo[2.2.1]heptane |
| SMILES | CC(C)(C)C(Br)CCCC1CC2CCC1C2 |
| InChI | InChI=1S/C15H27Br/c1-15(2,3)14(16)6-4-5-12-9-11-7-8-13(12)10-11/h11-14H,4-10H2,1-3H3 |
| InChIKey | ZCPPNLZTSJTQOX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|