About 2-(2-bicyclo[2.2.1]heptanylmethyl)-3,3-dimethylbutanoic acid
2-(2-bicyclo[2.2.1]heptanylmethyl)-3,3-dimethylbutanoic acid (PubChem CID 83139469) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylmethyl)-3,3-dimethylbutanoic acid.
Analyze 2-(2-bicyclo[2.2.1]heptanylmethyl)-3,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bicyclo[2.2.1]heptanylmethyl)-3,3-dimethylbutanoic acid?
The IUPAC name of 2-(2-bicyclo[2.2.1]heptanylmethyl)-3,3-dimethylbutanoic acid (CID 83139469) is 2-(2-bicyclo[2.2.1]heptanylmethyl)-3,3-dimethylbutanoic acid.
What is the SMILES notation for 2-(2-bicyclo[2.2.1]heptanylmethyl)-3,3-dimethylbutanoic acid?
The canonical SMILES for 2-(2-bicyclo[2.2.1]heptanylmethyl)-3,3-dimethylbutanoic acid is CC(C)(C)C(CC1CC2CCC1C2)C(=O)O.
What is the InChIKey of 2-(2-bicyclo[2.2.1]heptanylmethyl)-3,3-dimethylbutanoic acid?
The InChIKey is DTCAKBGSFGABAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c1-14(2,3)12(13(15)16)8-11-7-9-4-5-10(11)6-9/h9-12H,4-8H2,1-3H3,(H,15,16).
What are the key properties of 2-(2-bicyclo[2.2.1]heptanylmethyl)-3,3-dimethylbutanoic acid?
2-(2-bicyclo[2.2.1]heptanylmethyl)-3,3-dimethylbutanoic acid has a molecular weight of 224.34 g/mol, XLogP of 3.56, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bicyclo[2.2.1]heptanylmethyl)-3,3-dimethylbutanoic acid is sourced from PubChem (CID 83139469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).