C14H26O — CID 79558057
1-(2-bicyclo[2.2.1]heptanyl)-4,4-dimethylpentan-2-ol (PubChem CID 79558057) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-4,4-dimethylpentan-2-ol.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 79558057 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(O)CC1CC2CCC1C2 |
| InChI | InChI=1S/C14H26O/c1-14(2,3)9-13(15)8-12-7-10-4-5-11(12)6-10/h10-13,15H,4-9H2,1-3H3 |
| InChIKey | SRFGTZKNEONRSI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |