C15H18F6O3 — CID 90957271
2-(2-bicyclo[2.2.1]heptanylmethyl)-6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hex-2-enoic acid (PubChem CID 90957271) has the molecular formula C15H18F6O3 and a molecular weight of 360.29 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylmethyl)-6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hex-2-enoic acid.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylmethyl)-6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hex-2-enoic acid |
|---|---|
| PubChem CID | 90957271 |
| Molecular Formula | C15H18F6O3 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylmethyl)-6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hex-2-enoic acid |
| SMILES | O=C(O)C(=CCC(O)(C(F)(F)F)C(F)(F)F)CC1CC2CCC1C2 |
| InChI | InChI=1S/C15H18F6O3/c16-14(17,18)13(24,15(19,20)21)4-3-10(12(22)23)7-11-6-8-1-2-9(11)5-8/h3,8-9,11,24H,1-2,4-7H2,(H,22,23) |
| InChIKey | SRSIAAZHWSLUPC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|