C10H14F3NO3S — CID 155621422
2-(2-bicyclo[2.2.1]heptanyl)-N-(trifluoromethylsulfonyl)acetamide (PubChem CID 155621422) has the molecular formula C10H14F3NO3S and a molecular weight of 285.29 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-N-(trifluoromethylsulfonyl)acetamide.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-(trifluoromethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 155621422 |
| Molecular Formula | C10H14F3NO3S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-(trifluoromethylsulfonyl)acetamide |
| SMILES | O=C(CC1CC2CCC1C2)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO3S/c11-10(12,13)18(16,17)14-9(15)5-8-4-6-1-2-7(8)3-6/h6-8H,1-5H2,(H,14,15) |
| InChIKey | CBGGIVQBTQESDU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |