About 1,1,1,2,6-pentafluoro-2,6-dimethyl-4-propylheptane
1,1,1,2,6-pentafluoro-2,6-dimethyl-4-propylheptane (PubChem CID 87159283) has the molecular formula C12H21F5
and a molecular weight of 260.29 g/mol. Its IUPAC name is 1,1,1,2,6-pentafluoro-2,6-dimethyl-4-propylheptane.
Analyze 1,1,1,2,6-pentafluoro-2,6-dimethyl-4-propylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1,2,6-pentafluoro-2,6-dimethyl-4-propylheptane?
The IUPAC name of 1,1,1,2,6-pentafluoro-2,6-dimethyl-4-propylheptane (CID 87159283) is 1,1,1,2,6-pentafluoro-2,6-dimethyl-4-propylheptane.
What is the SMILES notation for 1,1,1,2,6-pentafluoro-2,6-dimethyl-4-propylheptane?
The canonical SMILES for 1,1,1,2,6-pentafluoro-2,6-dimethyl-4-propylheptane is CCCC(CC(C)(C)F)CC(C)(F)C(F)(F)F.
What is the InChIKey of 1,1,1,2,6-pentafluoro-2,6-dimethyl-4-propylheptane?
The InChIKey is HYLQVTGZGUREFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F5/c1-5-6-9(7-10(2,3)13)8-11(4,14)12(15,16)17/h9H,5-8H2,1-4H3.
What are the key properties of 1,1,1,2,6-pentafluoro-2,6-dimethyl-4-propylheptane?
1,1,1,2,6-pentafluoro-2,6-dimethyl-4-propylheptane has a molecular weight of 260.29 g/mol, XLogP of 5.22, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1,2,6-pentafluoro-2,6-dimethyl-4-propylheptane is sourced from PubChem (CID 87159283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).