C13H23F5 — CID 87159144
1,1,1,2,9-pentafluoro-2,4,9-trimethyldecane (PubChem CID 87159144) has the molecular formula C13H23F5 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1,1,1,2,9-pentafluoro-2,4,9-trimethyldecane.
| Compound Name | 1,1,1,2,9-pentafluoro-2,4,9-trimethyldecane |
|---|---|
| PubChem CID | 87159144 |
| Molecular Formula | C13H23F5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1,1,1,2,9-pentafluoro-2,4,9-trimethyldecane |
| SMILES | CC(CCCCC(C)(C)F)CC(C)(F)C(F)(F)F |
| InChI | InChI=1S/C13H23F5/c1-10(7-5-6-8-11(2,3)14)9-12(4,15)13(16,17)18/h10H,5-9H2,1-4H3 |
| InChIKey | AIHQVAMBOXEQER-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|