C22H46 — CID 123154666
4,4,6,12-tetramethyloctadecane (PubChem CID 123154666) has the molecular formula C22H46 and a molecular weight of 310.61 g/mol. Its IUPAC name is 4,4,6,12-tetramethyloctadecane.
| Compound Name | 4,4,6,12-tetramethyloctadecane |
|---|---|
| PubChem CID | 123154666 |
| Molecular Formula | C22H46 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.36 |
| IUPAC Name | 4,4,6,12-tetramethyloctadecane |
| SMILES | CCCCCCC(C)CCCCCC(C)CC(C)(C)CCC |
| InChI | InChI=1S/C22H46/c1-7-9-10-12-15-20(3)16-13-11-14-17-21(4)19-22(5,6)18-8-2/h20-21H,7-19H2,1-6H3 |
| InChIKey | FTLIGBWDOWYKSS-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|