C11H17F6I — CID 154402207
1,1,1-trifluoro-5-(2-iodoethyl)-2-(trifluoromethyl)octane (PubChem CID 154402207) has the molecular formula C11H17F6I and a molecular weight of 390.15 g/mol. Its IUPAC name is 1,1,1-trifluoro-5-(2-iodoethyl)-2-(trifluoromethyl)octane.
| Compound Name | 1,1,1-trifluoro-5-(2-iodoethyl)-2-(trifluoromethyl)octane |
|---|---|
| PubChem CID | 154402207 |
| Molecular Formula | C11H17F6I |
| Molecular Weight | 390.15 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 1,1,1-trifluoro-5-(2-iodoethyl)-2-(trifluoromethyl)octane |
| SMILES | CCCC(CCI)CCC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H17F6I/c1-2-3-8(6-7-18)4-5-9(10(12,13)14)11(15,16)17/h8-9H,2-7H2,1H3 |
| InChIKey | XUPXAYZDRTZPGH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.15 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|