C12H16F10 — CID 159243548
1,1,1,3,3,7,7,9,9,9-decafluoro-5-propylnonane (PubChem CID 159243548) has the molecular formula C12H16F10 and a molecular weight of 350.24 g/mol. Its IUPAC name is 1,1,1,3,3,7,7,9,9,9-decafluoro-5-propylnonane.
| Compound Name | 1,1,1,3,3,7,7,9,9,9-decafluoro-5-propylnonane |
|---|---|
| PubChem CID | 159243548 |
| Molecular Formula | C12H16F10 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 1,1,1,3,3,7,7,9,9,9-decafluoro-5-propylnonane |
| SMILES | CCCC(CC(F)(F)CC(F)(F)F)CC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C12H16F10/c1-2-3-8(4-9(13,14)6-11(17,18)19)5-10(15,16)7-12(20,21)22/h8H,2-7H2,1H3 |
| InChIKey | CPPFYXGVWIGTMN-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |