C9H11F9 — CID 58352388
1,1,1,3,3,5,5,7,7-nonafluorononane (PubChem CID 58352388) has the molecular formula C9H11F9 and a molecular weight of 290.17 g/mol. Its IUPAC name is 1,1,1,3,3,5,5,7,7-nonafluorononane.
| Compound Name | 1,1,1,3,3,5,5,7,7-nonafluorononane |
|---|---|
| PubChem CID | 58352388 |
| Molecular Formula | C9H11F9 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1,1,1,3,3,5,5,7,7-nonafluorononane |
| SMILES | CCC(F)(F)CC(F)(F)CC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C9H11F9/c1-2-6(10,11)3-7(12,13)4-8(14,15)5-9(16,17)18/h2-5H2,1H3 |
| InChIKey | PUVOAWDCDFZOHS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |