C9H16F5N — CID 156799901
N-methylmethanimine;1,1,1,3,3-pentafluoroheptane (PubChem CID 156799901) has the molecular formula C9H16F5N and a molecular weight of 233.22 g/mol. Its IUPAC name is N-methylmethanimine;1,1,1,3,3-pentafluoroheptane.
| Compound Name | N-methylmethanimine;1,1,1,3,3-pentafluoroheptane |
|---|---|
| PubChem CID | 156799901 |
| Molecular Formula | C9H16F5N |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-methylmethanimine;1,1,1,3,3-pentafluoroheptane |
| SMILES | C=NC.CCCCC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C7H11F5.C2H5N/c1-2-3-4-6(8,9)5-7(10,11)12;1-3-2/h2-5H2,1H3;1H2,2H3 |
| InChIKey | YKPRTVVREPMIDH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|