C13H18F10 — CID 158240546
5-butyl-1,1,1,3,3,7,7,9,9,9-decafluorononane (PubChem CID 158240546) has the molecular formula C13H18F10 and a molecular weight of 364.27 g/mol. Its IUPAC name is 5-butyl-1,1,1,3,3,7,7,9,9,9-decafluorononane.
| Compound Name | 5-butyl-1,1,1,3,3,7,7,9,9,9-decafluorononane |
|---|---|
| PubChem CID | 158240546 |
| Molecular Formula | C13H18F10 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 5-butyl-1,1,1,3,3,7,7,9,9,9-decafluorononane |
| SMILES | CCCCC(CC(F)(F)CC(F)(F)F)CC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C13H18F10/c1-2-3-4-9(5-10(14,15)7-12(18,19)20)6-11(16,17)8-13(21,22)23/h9H,2-8H2,1H3 |
| InChIKey | OXUKMUYWEVTDBV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |