C10H14F8 — CID 126493051
2,2,4,4,6,6,8,8-octafluorodecane (PubChem CID 126493051) has the molecular formula C10H14F8 and a molecular weight of 286.21 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8-octafluorodecane.
| Compound Name | 2,2,4,4,6,6,8,8-octafluorodecane |
|---|---|
| PubChem CID | 126493051 |
| Molecular Formula | C10H14F8 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2,2,4,4,6,6,8,8-octafluorodecane |
| SMILES | CCC(F)(F)CC(F)(F)CC(F)(F)CC(C)(F)F |
| InChI | InChI=1S/C10H14F8/c1-3-8(13,14)5-10(17,18)6-9(15,16)4-7(2,11)12/h3-6H2,1-2H3 |
| InChIKey | DTPTUPSEYQCBHV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |