C22H29F12NaO7S — CID 158902162
sodium 4-(3,3,5,5,7,7-hexafluorononoxy)-1-(4,4,6,6,8,8-hexafluorononoxy)-1,4-dioxobutane-2-sulfonate (PubChem CID 158902162) has the molecular formula C22H29F12NaO7S and a molecular weight of 688.50 g/mol. Its IUPAC name is sodium 4-(3,3,5,5,7,7-hexafluorononoxy)-1-(4,4,6,6,8,8-hexafluorononoxy)-1,4-dioxobutane-2-sulfonate.
| Compound Name | sodium 4-(3,3,5,5,7,7-hexafluorononoxy)-1-(4,4,6,6,8,8-hexafluorononoxy)-1,4-dioxobutane-2-sulfonate |
|---|---|
| PubChem CID | 158902162 |
| Molecular Formula | C22H29F12NaO7S |
| Molecular Weight | 688.50 g/mol |
| Exact Mass | 688.13 |
| IUPAC Name | sodium 4-(3,3,5,5,7,7-hexafluorononoxy)-1-(4,4,6,6,8,8-hexafluorononoxy)-1,4-dioxobutane-2-sulfonate |
| SMILES | CCC(F)(F)CC(F)(F)CC(F)(F)CCOC(=O)CC(C(=O)OCCCC(F)(F)CC(F)(F)CC(C)(F)F)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C22H30F12O7S.Na/c1-3-18(25,26)11-22(33,34)13-20(29,30)6-8-40-15(35)9-14(42(37,38)39)16(36)41-7-4-5-19(27,28)12-21(31,32)10-17(2,23)24;/h14H,3-13H2,1-2H3,(H,37,38,39);/q;+1/p-1 |
| InChIKey | FGKSTIGVBJMLLN-UHFFFAOYSA-M |
| XLogP | 3.35 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|